2-ETHYLACRYLIC ACID 98

Cost-effective customized wholesale 2-ETHYLACRYLIC ACID 98 3586-58-1 We provide high quality 2-ETHYLACRYLIC ACID 98 (CAS 3586-58-1), at a very affordable prices to our customers.

1.What is the 2-ETHYLACRYLIC ACID 98 ?

2-Ethylacrylic Acid 98, also known as 2-ethylacrylate or 2-ethylacrylic acid, is an alpha, beta-unsaturated monocarboxylic acid derived from acrylic acid with an ethyl group substitution at the 2-position. This chemical compound exhibits unique properties due to its unsaturated bond and ethyl substitution, making it a versatile building block in various industrial applications.

Used in Chemical Synthesis Industry:
2-Ethylacrylic Acid 98 is used as a monomer for the production of polymers and copolymers, which are essential in the development of various materials with tailored properties. Its alpha, beta-unsaturated bond allows for easy copolymerization with other monomers, resulting in materials with improved characteristics such as enhanced mechanical strength, flexibility, and chemical resistance.
Used in Adhesives and Sealants Industry:
2-Ethylacrylic Acid 98 is used as a reactive diluent or crosslinking agent in the formulation of adhesives and sealants. Its ability to copolymerize with other monomers allows for the creation of adhesives with specific properties, such as increased adhesion, improved durability, and resistance to environmental factors.
Used in Coatings Industry:
In the coatings industry, 2-Ethylacrylic Acid 98 is used as a comonomer to modify the properties of coatings. Its incorporation into coating formulations can lead to improved adhesion, durability, and resistance to chemicals, UV light, and weathering.
Used in Textile Industry:
2-Ethylacrylic Acid 98 is used in the textile industry for the development of specialty fibers and fabrics. Its copolymerization with other monomers can result in fibers with enhanced mechanical properties, improved dyeability, and increased resistance to environmental factors.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Ethylacrylic Acid 98 can be used as an intermediate in the synthesis of various drug molecules. Its unique chemical structure allows for the development of new compounds with potential therapeutic applications.
Used in Agriculture Industry:
2-Ethylacrylic Acid 98 can be used in the agriculture industry for the development of novel agrochemicals, such as herbicides, pesticides, and fertilizers. Its chemical properties can be harnessed to create products with improved efficacy, reduced environmental impact, and increased selectivity for target organisms.

2.What is the CAS number for 2-ETHYLACRYLIC ACID 98 ?

The CAS number of 2-ETHYLACRYLIC ACID 98 is 3586-58-1.

More information of 2-ETHYLACRYLIC ACID 98 3586-58-1 are:

3.What is the molecular formula of 2-ETHYLACRYLIC ACID 98 ?

The chemical formula of?2-ETHYLACRYLIC ACID 98 is C5H8 O2 which containing 5 Carbon atoms,8 Hydrogen atoms and 2 Oxygen atoms,and the molecular weight, and the molecular weight of 2-ETHYLACRYLIC ACID 98 is 100.117

4.What is 2-ETHYLACRYLIC ACID 98(3586-58-1)used for?

2-Ethylacrylic Acid 98, also known as 2-ethylacrylate or 2-ethylacrylic acid, is an alpha, beta-unsaturated monocarboxylic acid derived from acrylic acid with an ethyl group substitution at the 2-position. This chemical compound exhibits unique properties due to its unsaturated bond and ethyl substitution, making it a versatile building block in various industrial applications.

InChI:InChI=1/C5H8O2/c1-3-4(2)5(6)7/h2-3H2,1H3,(H,6,7)

Relevant articles related to 2-ETHYLACRYLIC ACID 98:

5.Cost-effective customized wholesale 2-ETHYLACRYLIC ACID 98 3586-58-1

Hebei shuangsheng trading co.,ltd is a quality supplier of 2-ETHYLACRYLIC ACID 98. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 2-ETHYLACRYLIC ACID 98 3586-58-1.